C25H31FN2O4S — CID 118223155
2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide (PubChem CID 118223155) has the molecular formula C25H31FN2O4S and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide.
| Compound Name | 2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 118223155 |
| Molecular Formula | C25H31FN2O4S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-2-fluorophenyl]methyl]-3-methyl-6-phenylthiazinane 1,1-dioxide |
| SMILES | CC1CCC(c2ccccc2)S(=O)(=O)N1Cc1ccc(N2CCC3(CC2)OCCO3)cc1F |
| InChI | InChI=1S/C25H31FN2O4S/c1-19-7-10-24(20-5-3-2-4-6-20)33(29,30)28(19)18-21-8-9-22(17-23(21)26)27-13-11-25(12-14-27)31-15-16-32-25/h2-6,8-9,17,19,24H,7,10-16,18H2,1H3 |
| InChIKey | ZRJKLYPKKDRICK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|