C25H31FN4O4S — CID 72948174
(2R)-4-acetyl-1-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]piperazine-2-carboxamide (PubChem CID 72948174) has the molecular formula C25H31FN4O4S and a molecular weight of 502.61 g/mol. Its IUPAC name is (2R)-4-acetyl-1-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]piperazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-1-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 72948174 |
| Molecular Formula | C25H31FN4O4S |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (2R)-4-acetyl-1-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]piperazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CCC(c4ccccc4)S3(=O)=O)c(F)c2)[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C25H31FN4O4S/c1-17-8-11-24(19-6-4-3-5-7-19)35(33,34)30(17)15-20-9-10-21(14-22(20)26)29-13-12-28(18(2)31)16-23(29)25(27)32/h3-7,9-10,14,17,23-24H,8,11-13,15-16H2,1-2H3,(H2,27,32)/t17-,23+,24?/m0/s1 |
| InChIKey | CHGSKNULROKVPN-HDTCWFHRSA-N |
| XLogP | 2.40 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|