C25H29FN4O3S — CID 155559009
2-[(3S,6R)-2-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-3-methyl-1,1-dioxothiazinan-6-yl]benzonitrile (PubChem CID 155559009) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[(3S,6R)-2-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-3-methyl-1,1-dioxothiazinan-6-yl]benzonitrile.
| Compound Name | 2-[(3S,6R)-2-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-3-methyl-1,1-dioxothiazinan-6-yl]benzonitrile |
|---|---|
| PubChem CID | 155559009 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-[(3S,6R)-2-[[4-(4-acetylpiperazin-1-yl)-2-fluorophenyl]methyl]-3-methyl-1,1-dioxothiazinan-6-yl]benzonitrile |
| SMILES | CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4C#N)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-18-7-10-25(23-6-4-3-5-20(23)16-27)34(32,33)30(18)17-21-8-9-22(15-24(21)26)29-13-11-28(12-14-29)19(2)31/h3-6,8-9,15,18,25H,7,10-14,17H2,1-2H3/t18-,25+/m0/s1 |
| InChIKey | BZJOXTQPRHHULS-AVRWGWEMSA-N |
| XLogP | 3.42 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|