C25H28FN5O2S — CID 72948723
7-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3,5,6,8-tetrahydro-2H-imidazo[1,5-a]pyrazine-3-carbonitrile (PubChem CID 72948723) has the molecular formula C25H28FN5O2S and a molecular weight of 481.60 g/mol. Its IUPAC name is 7-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3,5,6,8-tetrahydro-2H-imidazo[1,5-a]pyrazine-3-carbonitrile.
| Compound Name | 7-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3,5,6,8-tetrahydro-2H-imidazo[1,5-a]pyrazine-3-carbonitrile |
|---|---|
| PubChem CID | 72948723 |
| Molecular Formula | C25H28FN5O2S |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 7-[3-fluoro-4-[[(3S)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3,5,6,8-tetrahydro-2H-imidazo[1,5-a]pyrazine-3-carbonitrile |
| SMILES | C[C@H]1CCC(c2ccccc2)S(=O)(=O)N1Cc1ccc(N2CCN3C(=CNC3C#N)C2)cc1F |
| InChI | InChI=1S/C25H28FN5O2S/c1-18-7-10-24(19-5-3-2-4-6-19)34(32,33)31(18)16-20-8-9-21(13-23(20)26)29-11-12-30-22(17-29)15-28-25(30)14-27/h2-6,8-9,13,15,18,24-25,28H,7,10-12,16-17H2,1H3/t18-,24?,25?/m0/s1 |
| InChIKey | KVBZHCXCFBEQLK-UTTDKNERSA-N |
| XLogP | 3.30 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|