C26H34FN3O4S — CID 170905132
tert-butyl 4-[4-[[benzenesulfonyl(cyclobutyl)amino]methyl]-3-fluorophenyl]piperazine-1-carboxylate (PubChem CID 170905132) has the molecular formula C26H34FN3O4S and a molecular weight of 503.64 g/mol. Its IUPAC name is tert-butyl 4-[4-[[benzenesulfonyl(cyclobutyl)amino]methyl]-3-fluorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[benzenesulfonyl(cyclobutyl)amino]methyl]-3-fluorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170905132 |
| Molecular Formula | C26H34FN3O4S |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | tert-butyl 4-[4-[[benzenesulfonyl(cyclobutyl)amino]methyl]-3-fluorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CN(C3CCC3)S(=O)(=O)c3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H34FN3O4S/c1-26(2,3)34-25(31)29-16-14-28(15-17-29)22-13-12-20(24(27)18-22)19-30(21-8-7-9-21)35(32,33)23-10-5-4-6-11-23/h4-6,10-13,18,21H,7-9,14-17,19H2,1-3H3 |
| InChIKey | BBWBRVPEIQGGRB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|