C17H24FN3O2 — CID 18291247
N-carbamoyl-3-[cyclohexyl-[(4-fluorophenyl)methyl]amino]propanamide (PubChem CID 18291247) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is N-carbamoyl-3-[cyclohexyl-[(4-fluorophenyl)methyl]amino]propanamide.
| Compound Name | N-carbamoyl-3-[cyclohexyl-[(4-fluorophenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 18291247 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-carbamoyl-3-[cyclohexyl-[(4-fluorophenyl)methyl]amino]propanamide |
| SMILES | NC(=O)NC(=O)CCN(Cc1ccc(F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C17H24FN3O2/c18-14-8-6-13(7-9-14)12-21(15-4-2-1-3-5-15)11-10-16(22)20-17(19)23/h6-9,15H,1-5,10-12H2,(H3,19,20,22,23) |
| InChIKey | UGMJYYNXTLZGAZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |