C13H15F3N2S — CID 71893762
1-cyclopropyl-3-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 71893762) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-cyclopropyl-3-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 71893762 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-cyclopropyl-3-methyl-1-[[2-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CNC(=S)N(Cc1ccccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C13H15F3N2S/c1-17-12(19)18(10-6-7-10)8-9-4-2-3-5-11(9)13(14,15)16/h2-5,10H,6-8H2,1H3,(H,17,19) |
| InChIKey | VDGATONXINCFQV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|