C15H15F3N4O — CID 126768034
N-cyclopropyl-5-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]-2H-triazole-4-carboxamide (PubChem CID 126768034) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is N-cyclopropyl-5-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]-2H-triazole-4-carboxamide.
| Compound Name | N-cyclopropyl-5-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 126768034 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-cyclopropyl-5-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]-2H-triazole-4-carboxamide |
| SMILES | Cc1n[nH]nc1C(=O)N(Cc1ccccc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C15H15F3N4O/c1-9-13(20-21-19-9)14(23)22(11-6-7-11)8-10-4-2-3-5-12(10)15(16,17)18/h2-5,11H,6-8H2,1H3,(H,19,20,21) |
| InChIKey | LZCNRWNPMLQOAV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |