C22H17ClF4N2S — CID 44665630
1-benzyl-3-[5-chloro-2-(trifluoromethyl)phenyl]-1-[(2-fluorophenyl)methyl]thiourea (PubChem CID 44665630) has the molecular formula C22H17ClF4N2S and a molecular weight of 452.90 g/mol. Its IUPAC name is 1-benzyl-3-[5-chloro-2-(trifluoromethyl)phenyl]-1-[(2-fluorophenyl)methyl]thiourea.
| Compound Name | 1-benzyl-3-[5-chloro-2-(trifluoromethyl)phenyl]-1-[(2-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 44665630 |
| Molecular Formula | C22H17ClF4N2S |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 1-benzyl-3-[5-chloro-2-(trifluoromethyl)phenyl]-1-[(2-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccccc1CN(Cc1ccccc1)C(=S)Nc1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H17ClF4N2S/c23-17-10-11-18(22(25,26)27)20(12-17)28-21(30)29(13-15-6-2-1-3-7-15)14-16-8-4-5-9-19(16)24/h1-12H,13-14H2,(H,28,30) |
| InChIKey | CZSYAHKXCFZHSC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|