C22H22ClF3N4S — CID 4123623
3-[5-chloro-2-(trifluoromethyl)phenyl]-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea (PubChem CID 4123623) has the molecular formula C22H22ClF3N4S and a molecular weight of 466.96 g/mol. Its IUPAC name is 3-[5-chloro-2-(trifluoromethyl)phenyl]-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea.
| Compound Name | 3-[5-chloro-2-(trifluoromethyl)phenyl]-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4123623 |
| Molecular Formula | C22H22ClF3N4S |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 3-[5-chloro-2-(trifluoromethyl)phenyl]-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccccc1CN(CCCn1ccnc1)C(=S)Nc1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C22H22ClF3N4S/c1-16-5-2-3-6-17(16)14-30(11-4-10-29-12-9-27-15-29)21(31)28-20-13-18(23)7-8-19(20)22(24,25)26/h2-3,5-9,12-13,15H,4,10-11,14H2,1H3,(H,28,31) |
| InChIKey | UIMYOONCOXSEPL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|