C24H30N4S — CID 17382552
3-(2-ethyl-3-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea (PubChem CID 17382552) has the molecular formula C24H30N4S and a molecular weight of 406.60 g/mol. Its IUPAC name is 3-(2-ethyl-3-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea.
| Compound Name | 3-(2-ethyl-3-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 17382552 |
| Molecular Formula | C24H30N4S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 3-(2-ethyl-3-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
| SMILES | CCc1c(C)cccc1NC(=S)N(CCCn1ccnc1)Cc1ccccc1C |
| InChI | InChI=1S/C24H30N4S/c1-4-22-20(3)10-7-12-23(22)26-24(29)28(15-8-14-27-16-13-25-18-27)17-21-11-6-5-9-19(21)2/h5-7,9-13,16,18H,4,8,14-15,17H2,1-3H3,(H,26,29) |
| InChIKey | ZAVQXTQWFUSAMI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|