C21H31ClN4S — CID 4319131
1-[(2-chlorophenyl)methyl]-3-heptyl-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 4319131) has the molecular formula C21H31ClN4S and a molecular weight of 407.03 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-heptyl-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-heptyl-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4319131 |
| Molecular Formula | C21H31ClN4S |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-heptyl-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | CCCCCCCNC(=S)N(CCCn1ccnc1)Cc1ccccc1Cl |
| InChI | InChI=1S/C21H31ClN4S/c1-2-3-4-5-8-12-24-21(27)26(15-9-14-25-16-13-23-18-25)17-19-10-6-7-11-20(19)22/h6-7,10-11,13,16,18H,2-5,8-9,12,14-15,17H2,1H3,(H,24,27) |
| InChIKey | NJBAITMSEUQPLC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|