C22H25ClN4S — CID 4110485
3-(3-chloro-4-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea (PubChem CID 4110485) has the molecular formula C22H25ClN4S and a molecular weight of 412.99 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 4110485 |
| Molecular Formula | C22H25ClN4S |
| Molecular Weight | 412.99 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(2-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCCn2ccnc2)Cc2ccccc2C)cc1Cl |
| InChI | InChI=1S/C22H25ClN4S/c1-17-6-3-4-7-19(17)15-27(12-5-11-26-13-10-24-16-26)22(28)25-20-9-8-18(2)21(23)14-20/h3-4,6-10,13-14,16H,5,11-12,15H2,1-2H3,(H,25,28) |
| InChIKey | ZIJBBSUFQPJSCX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.99 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|