C24H29ClN2O2S — CID 4547692
4-[[(3-chloro-4-methylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 4547692) has the molecular formula C24H29ClN2O2S and a molecular weight of 445.03 g/mol. Its IUPAC name is 4-[[(3-chloro-4-methylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(3-chloro-4-methylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 4547692 |
| Molecular Formula | C24H29ClN2O2S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 4-[[(3-chloro-4-methylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(NC(=S)N(Cc2ccccc2C)CC2CCC(C(=O)O)CC2)cc1Cl |
| InChI | InChI=1S/C24H29ClN2O2S/c1-16-5-3-4-6-20(16)15-27(14-18-8-10-19(11-9-18)23(28)29)24(30)26-21-12-7-17(2)22(25)13-21/h3-7,12-13,18-19H,8-11,14-15H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | PDOUFONUZSSBRS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|