C23H28N4OS — CID 3392125
3-(3,5-dimethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 3392125) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 3-(3,5-dimethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3392125 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-(3-imidazol-1-ylpropyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(CCCn2ccnc2)C(=S)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-18-13-19(2)15-21(14-18)25-23(29)27(11-4-10-26-12-9-24-17-26)16-20-5-7-22(28-3)8-6-20/h5-9,12-15,17H,4,10-11,16H2,1-3H3,(H,25,29) |
| InChIKey | VXCHRICBJWOVGY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|