C19H27N5S — CID 4688008
1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)-3-prop-2-enylthiourea (PubChem CID 4688008) has the molecular formula C19H27N5S and a molecular weight of 357.53 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)-3-prop-2-enylthiourea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 4688008 |
| Molecular Formula | C19H27N5S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N(CCCn1ccnc1)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H27N5S/c1-4-10-21-19(25)24(13-5-12-23-14-11-20-16-23)15-17-6-8-18(9-7-17)22(2)3/h4,6-9,11,14,16H,1,5,10,12-13,15H2,2-3H3,(H,21,25) |
| InChIKey | RIDINMXBBYGGKR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|