C22H25F2N5O — CID 42706560
3-(2,4-difluorophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)urea (PubChem CID 42706560) has the molecular formula C22H25F2N5O and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 42706560 |
| Molecular Formula | C22H25F2N5O |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-imidazol-1-ylpropyl)urea |
| SMILES | CN(C)c1ccc(CN(CCCn2ccnc2)C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C22H25F2N5O/c1-27(2)19-7-4-17(5-8-19)15-29(12-3-11-28-13-10-25-16-28)22(30)26-21-9-6-18(23)14-20(21)24/h4-10,13-14,16H,3,11-12,15H2,1-2H3,(H,26,30) |
| InChIKey | DZZJNIASKAOVAY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|