C22H25FN4OS — CID 4549002
1-[(2-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(4-methoxy-2-methylphenyl)thiourea (PubChem CID 4549002) has the molecular formula C22H25FN4OS and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(4-methoxy-2-methylphenyl)thiourea.
| Compound Name | 1-[(2-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(4-methoxy-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 4549002 |
| Molecular Formula | C22H25FN4OS |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(4-methoxy-2-methylphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CCCn2ccnc2)Cc2ccccc2F)c(C)c1 |
| InChI | InChI=1S/C22H25FN4OS/c1-17-14-19(28-2)8-9-21(17)25-22(29)27(12-5-11-26-13-10-24-16-26)15-18-6-3-4-7-20(18)23/h3-4,6-10,13-14,16H,5,11-12,15H2,1-2H3,(H,25,29) |
| InChIKey | VETXFDUEVITDCO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|