C23H27ClN4O2S — CID 4198896
3-(3-chloro-2-methylphenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 4198896) has the molecular formula C23H27ClN4O2S and a molecular weight of 459.02 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4198896 |
| Molecular Formula | C23H27ClN4O2S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-[(2,4-dimethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | COc1ccc(CN(CCCn2ccnc2)C(=S)Nc2cccc(Cl)c2C)c(OC)c1 |
| InChI | InChI=1S/C23H27ClN4O2S/c1-17-20(24)6-4-7-21(17)26-23(31)28(12-5-11-27-13-10-25-16-27)15-18-8-9-19(29-2)14-22(18)30-3/h4,6-10,13-14,16H,5,11-12,15H2,1-3H3,(H,26,31) |
| InChIKey | VFZZLCHRMBNNBT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|