C14H19FN2OS — CID 100641512
3-(4-fluorophenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]-1-methylthiourea (PubChem CID 100641512) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]-1-methylthiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]-1-methylthiourea |
|---|---|
| PubChem CID | 100641512 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]-1-methylthiourea |
| SMILES | CN(C(=S)Nc1ccc(F)cc1)[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H19FN2OS/c1-17(12-4-2-3-5-13(12)18)14(19)16-11-8-6-10(15)7-9-11/h6-9,12-13,18H,2-5H2,1H3,(H,16,19)/t12-,13-/m1/s1 |
| InChIKey | FLLZTTDLKDXVQN-CHWSQXEVSA-N |
| XLogP | 2.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|