C23H23FN6S — CID 6498524
1-cyclopentyl-3-(4-fluorophenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea (PubChem CID 6498524) has the molecular formula C23H23FN6S and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-fluorophenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 6498524 |
| Molecular Formula | C23H23FN6S |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
| SMILES | Cc1ccc2c(c1)cc(CN(C(=S)Nc1ccc(F)cc1)C1CCCC1)c1nnnn12 |
| InChI | InChI=1S/C23H23FN6S/c1-15-6-11-21-16(12-15)13-17(22-26-27-28-30(21)22)14-29(20-4-2-3-5-20)23(31)25-19-9-7-18(24)8-10-19/h6-13,20H,2-5,14H2,1H3,(H,25,31) |
| InChIKey | ZKEWMJZZGWIKBP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|