C21H28N6S — CID 3221115
3-butyl-1-cyclopentyl-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea (PubChem CID 3221115) has the molecular formula C21H28N6S and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-butyl-1-cyclopentyl-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea.
| Compound Name | 3-butyl-1-cyclopentyl-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3221115 |
| Molecular Formula | C21H28N6S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 3-butyl-1-cyclopentyl-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
| SMILES | CCCCNC(=S)N(Cc1cc2cc(C)ccc2n2nnnc12)C1CCCC1 |
| InChI | InChI=1S/C21H28N6S/c1-3-4-11-22-21(28)26(18-7-5-6-8-18)14-17-13-16-12-15(2)9-10-19(16)27-20(17)23-24-25-27/h9-10,12-13,18H,3-8,11,14H2,1-2H3,(H,22,28) |
| InChIKey | HWVZHKYHNJEZRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|