C24H26N6S — CID 1445458
1-cyclopentyl-3-(3-methylphenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea (PubChem CID 1445458) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-(3-methylphenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-(3-methylphenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1445458 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-cyclopentyl-3-(3-methylphenyl)-1-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]thiourea |
| SMILES | Cc1cccc(NC(=S)N(Cc2cc3cc(C)ccc3n3nnnc23)C2CCCC2)c1 |
| InChI | InChI=1S/C24H26N6S/c1-16-6-5-7-20(13-16)25-24(31)29(21-8-3-4-9-21)15-19-14-18-12-17(2)10-11-22(18)30-23(19)26-27-28-30/h5-7,10-14,21H,3-4,8-9,15H2,1-2H3,(H,25,31) |
| InChIKey | SZMQISFDIBWUED-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|