C23H24N6S — CID 1454917
1-cyclopropyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(3-methylphenyl)thiourea (PubChem CID 1454917) has the molecular formula C23H24N6S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(3-methylphenyl)thiourea.
| Compound Name | 1-cyclopropyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 1454917 |
| Molecular Formula | C23H24N6S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-cyclopropyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(3-methylphenyl)thiourea |
| SMILES | CCc1ccc2c(c1)cc(CN(C(=S)Nc1cccc(C)c1)C1CC1)c1nnnn12 |
| InChI | InChI=1S/C23H24N6S/c1-3-16-7-10-21-17(12-16)13-18(22-25-26-27-29(21)22)14-28(20-8-9-20)23(30)24-19-6-4-5-15(2)11-19/h4-7,10-13,20H,3,8-9,14H2,1-2H3,(H,24,30) |
| InChIKey | VBZAXIFKWQVMOM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|