C26H37N3OS — CID 17371039
3-(2,5-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17371039) has the molecular formula C26H37N3OS and a molecular weight of 439.67 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-(2,5-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17371039 |
| Molecular Formula | C26H37N3OS |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | COc1ccccc1CN(C(=S)Nc1cc(C)ccc1C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C26H37N3OS/c1-18-12-13-19(2)22(14-18)27-24(31)29(17-20-10-8-9-11-23(20)30-7)21-15-25(3,4)28-26(5,6)16-21/h8-14,21,28H,15-17H2,1-7H3,(H,27,31) |
| InChIKey | QPNBBOKRQHJWIG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|