C27H39N3O3S — CID 23098510
3-(2,5-dimethoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 23098510) has the molecular formula C27H39N3O3S and a molecular weight of 485.69 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 3-(2,5-dimethoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 23098510 |
| Molecular Formula | C27H39N3O3S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-1-[(2-ethoxyphenyl)methyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CCOc1ccccc1CN(C(=S)Nc1cc(OC)ccc1OC)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H39N3O3S/c1-8-33-23-12-10-9-11-19(23)18-30(20-16-26(2,3)29-27(4,5)17-20)25(34)28-22-15-21(31-6)13-14-24(22)32-7/h9-15,20,29H,8,16-18H2,1-7H3,(H,28,34) |
| InChIKey | GUPAMZFUNVXUNP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|