C21H25Cl2N3OS — CID 3469414
3-(5-chloro-2-methoxyphenyl)-1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 3469414) has the molecular formula C21H25Cl2N3OS and a molecular weight of 438.42 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 3469414 |
| Molecular Formula | C21H25Cl2N3OS |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-1-[(2-chlorophenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)N(Cc1ccccc1Cl)C1CCN(C)CC1 |
| InChI | InChI=1S/C21H25Cl2N3OS/c1-25-11-9-17(10-12-25)26(14-15-5-3-4-6-18(15)23)21(28)24-19-13-16(22)7-8-20(19)27-2/h3-8,13,17H,9-12,14H2,1-2H3,(H,24,28) |
| InChIKey | SDJOXKXHHSZFTD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|