C22H35N3OS — CID 17338584
N-[(2-ethoxyphenyl)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 17338584) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 17338584 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCOc1ccccc1CN(C1=NCCCS1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H35N3OS/c1-6-26-19-11-8-7-10-17(19)16-25(20-23-12-9-13-27-20)18-14-21(2,3)24-22(4,5)15-18/h7-8,10-11,18,24H,6,9,12-16H2,1-5H3 |
| InChIKey | OETCIUJVLYWEPP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |