C21H32N6O — CID 19145913
6-N-(2-ethoxyphenyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine (PubChem CID 19145913) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is 6-N-(2-ethoxyphenyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2-ethoxyphenyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19145913 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 6-N-(2-ethoxyphenyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
| SMILES | CCOc1ccccc1Nc1ncnc(NC2CC(C)(C)NC(C)(C)C2)c1N |
| InChI | InChI=1S/C21H32N6O/c1-6-28-16-10-8-7-9-15(16)26-19-17(22)18(23-13-24-19)25-14-11-20(2,3)27-21(4,5)12-14/h7-10,13-14,27H,6,11-12,22H2,1-5H3,(H2,23,24,25,26) |
| InChIKey | HQNSYPFQOOOPQI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |