C18H26ClN7 — CID 19145920
6-N-(2-chloro-3-pyridinyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine (PubChem CID 19145920) has the molecular formula C18H26ClN7 and a molecular weight of 375.91 g/mol. Its IUPAC name is 6-N-(2-chloro-3-pyridinyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2-chloro-3-pyridinyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19145920 |
| Molecular Formula | C18H26ClN7 |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 6-N-(2-chloro-3-pyridinyl)-4-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidine-4,5,6-triamine |
| SMILES | CC1(C)CC(Nc2ncnc(Nc3cccnc3Cl)c2N)CC(C)(C)N1 |
| InChI | InChI=1S/C18H26ClN7/c1-17(2)8-11(9-18(3,4)26-17)24-15-13(20)16(23-10-22-15)25-12-6-5-7-21-14(12)19/h5-7,10-11,26H,8-9,20H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | PAQRHAIBMOMSCG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|