C15H12ClFN6 — CID 19149079
4-N-(2-chloro-3-pyridinyl)-6-N-(4-fluorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19149079) has the molecular formula C15H12ClFN6 and a molecular weight of 330.75 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-N-(4-fluorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(4-fluorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19149079 |
| Molecular Formula | C15H12ClFN6 |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(4-fluorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccc(F)cc2)ncnc1Nc1cccnc1Cl |
| InChI | InChI=1S/C15H12ClFN6/c16-13-11(2-1-7-19-13)23-15-12(18)14(20-8-21-15)22-10-5-3-9(17)4-6-10/h1-8H,18H2,(H2,20,21,22,23) |
| InChIKey | INVAUOVAKUWRTO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|