C29H43N3OS — CID 17382517
1-[(2-ethoxyphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea (PubChem CID 17382517) has the molecular formula C29H43N3OS and a molecular weight of 481.75 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 17382517 |
| Molecular Formula | C29H43N3OS |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-3-(3-methyl-2-propan-2-ylphenyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)thiourea |
| SMILES | CCOc1ccccc1CN(C(=S)Nc1cccc(C)c1C(C)C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H43N3OS/c1-9-33-25-16-11-10-14-22(25)19-32(23-17-28(5,6)31-29(7,8)18-23)27(34)30-24-15-12-13-21(4)26(24)20(2)3/h10-16,20,23,31H,9,17-19H2,1-8H3,(H,30,34) |
| InChIKey | PXIBSFUTLGBRSN-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|