C22H31N3OS — CID 3540199
1-(furan-2-ylmethyl)-1-(1-methylpiperidin-4-yl)-3-(3-methyl-2-propan-2-ylphenyl)thiourea (PubChem CID 3540199) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-(1-methylpiperidin-4-yl)-3-(3-methyl-2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-1-(1-methylpiperidin-4-yl)-3-(3-methyl-2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 3540199 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-(1-methylpiperidin-4-yl)-3-(3-methyl-2-propan-2-ylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)N(Cc2ccco2)C2CCN(C)CC2)c1C(C)C |
| InChI | InChI=1S/C22H31N3OS/c1-16(2)21-17(3)7-5-9-20(21)23-22(27)25(15-19-8-6-14-26-19)18-10-12-24(4)13-11-18/h5-9,14,16,18H,10-13,15H2,1-4H3,(H,23,27) |
| InChIKey | QQLFRDPDFPRNSM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|