C26H33N3OS — CID 53206863
1-cyclohexyl-3-(2-ethoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea (PubChem CID 53206863) has the molecular formula C26H33N3OS and a molecular weight of 435.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-ethoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea.
| Compound Name | 1-cyclohexyl-3-(2-ethoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 53206863 |
| Molecular Formula | C26H33N3OS |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-cyclohexyl-3-(2-ethoxyphenyl)-1-[(1-ethylindol-3-yl)methyl]thiourea |
| SMILES | CCOc1ccccc1NC(=S)N(Cc1cn(CC)c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C26H33N3OS/c1-3-28-18-20(22-14-8-10-16-24(22)28)19-29(21-12-6-5-7-13-21)26(31)27-23-15-9-11-17-25(23)30-4-2/h8-11,14-18,21H,3-7,12-13,19H2,1-2H3,(H,27,31) |
| InChIKey | LZQUGFUSMWOZCH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|