C22H27N3S — CID 53206865
1-[(1-ethylindol-3-yl)methyl]-3-(2-methylphenyl)-1-propan-2-ylthiourea (PubChem CID 53206865) has the molecular formula C22H27N3S and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-[(1-ethylindol-3-yl)methyl]-3-(2-methylphenyl)-1-propan-2-ylthiourea.
| Compound Name | 1-[(1-ethylindol-3-yl)methyl]-3-(2-methylphenyl)-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 53206865 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 1-[(1-ethylindol-3-yl)methyl]-3-(2-methylphenyl)-1-propan-2-ylthiourea |
| SMILES | CCn1cc(CN(C(=S)Nc2ccccc2C)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H27N3S/c1-5-24-14-18(19-11-7-9-13-21(19)24)15-25(16(2)3)22(26)23-20-12-8-6-10-17(20)4/h6-14,16H,5,15H2,1-4H3,(H,23,26) |
| InChIKey | XWLAHFBZJKFUFJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|