C19H21N3O — CID 40519720
1-(2,3-dimethylphenyl)-3-(1-ethylindol-3-yl)urea (PubChem CID 40519720) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(1-ethylindol-3-yl)urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(1-ethylindol-3-yl)urea |
|---|---|
| PubChem CID | 40519720 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(1-ethylindol-3-yl)urea |
| SMILES | CCn1cc(NC(=O)Nc2cccc(C)c2C)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O/c1-4-22-12-17(15-9-5-6-11-18(15)22)21-19(23)20-16-10-7-8-13(2)14(16)3/h5-12H,4H2,1-3H3,(H2,20,21,23) |
| InChIKey | MFENDSAVAPAVTA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |