C19H20FN3O — CID 18582399
1-(1-ethylindol-3-yl)-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 18582399) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-(1-ethylindol-3-yl)-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-(1-ethylindol-3-yl)-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 18582399 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 1-(1-ethylindol-3-yl)-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | CCn1cc(NC(=O)NCCc2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H20FN3O/c1-2-23-13-17(16-5-3-4-6-18(16)23)22-19(24)21-12-11-14-7-9-15(20)10-8-14/h3-10,13H,2,11-12H2,1H3,(H2,21,22,24) |
| InChIKey | IRZNFQZNKXFIIT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |