C19H21N3O2 — CID 18582320
1-[2-(4-methoxyphenyl)ethyl]-3-(1-methylindol-3-yl)urea (PubChem CID 18582320) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-3-(1-methylindol-3-yl)urea.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-3-(1-methylindol-3-yl)urea |
|---|---|
| PubChem CID | 18582320 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-3-(1-methylindol-3-yl)urea |
| SMILES | COc1ccc(CCNC(=O)Nc2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C19H21N3O2/c1-22-13-17(16-5-3-4-6-18(16)22)21-19(23)20-12-11-14-7-9-15(24-2)10-8-14/h3-10,13H,11-12H2,1-2H3,(H2,20,21,23) |
| InChIKey | XPHHNXXIVWHJTL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |