C27H31FN4O — CID 11762084
1-[2-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 11762084) has the molecular formula C27H31FN4O and a molecular weight of 446.57 g/mol. Its IUPAC name is 1-[2-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[2-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 11762084 |
| Molecular Formula | C27H31FN4O |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[2-[(4-benzylpiperazin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(F)cc1)Nc1ccccc1CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H31FN4O/c28-25-12-10-22(11-13-25)14-15-29-27(33)30-26-9-5-4-8-24(26)21-32-18-16-31(17-19-32)20-23-6-2-1-3-7-23/h1-13H,14-21H2,(H2,29,30,33) |
| InChIKey | MOMUBAOCDLVZRF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |