C28H32FN3O — CID 23497310
1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 23497310) has the molecular formula C28H32FN3O and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 23497310 |
| Molecular Formula | C28H32FN3O |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 1-[3-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(F)cc1)Nc1cccc(CN2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C28H32FN3O/c29-26-11-9-22(10-12-26)13-16-30-28(33)31-27-8-4-7-25(20-27)21-32-17-14-24(15-18-32)19-23-5-2-1-3-6-23/h1-12,20,24H,13-19,21H2,(H2,30,31,33) |
| InChIKey | JZVBAPJPEYDKAL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |