C27H28FN3O2 — CID 10884773
1-[2-[2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetyl]phenyl]-3-phenylurea (PubChem CID 10884773) has the molecular formula C27H28FN3O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[2-[2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetyl]phenyl]-3-phenylurea.
| Compound Name | 1-[2-[2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 10884773 |
| Molecular Formula | C27H28FN3O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 1-[2-[2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1C(=O)CN1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H28FN3O2/c28-22-12-10-20(11-13-22)18-21-14-16-31(17-15-21)19-26(32)24-8-4-5-9-25(24)30-27(33)29-23-6-2-1-3-7-23/h1-13,21H,14-19H2,(H2,29,30,33) |
| InChIKey | ONKMAERNIGHVLS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |