C27H31N3O2 — CID 11102050
1-[3-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-phenylurea (PubChem CID 11102050) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[3-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-phenylurea.
| Compound Name | 1-[3-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 11102050 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[3-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(C(O)CN2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H31N3O2/c31-26(20-30-16-14-22(15-17-30)18-21-8-3-1-4-9-21)23-10-7-13-25(19-23)29-27(32)28-24-11-5-2-6-12-24/h1-13,19,22,26,31H,14-18,20H2,(H2,28,29,32) |
| InChIKey | OBHVQSQUOOYRGT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |