C24H30FN3O — CID 91479957
2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-N-phenylpyrrolidine-1-carboxamide (PubChem CID 91479957) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-N-phenylpyrrolidine-1-carboxamide.
| Compound Name | 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-N-phenylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91479957 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methyl]-N-phenylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCCC1CN1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H30FN3O/c25-21-10-8-19(9-11-21)17-20-12-15-27(16-13-20)18-23-7-4-14-28(23)24(29)26-22-5-2-1-3-6-22/h1-3,5-6,8-11,20,23H,4,7,12-18H2,(H,26,29) |
| InChIKey | DWNDCGLMHIIJTQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |