C20H26Cl2FN3O — CID 69100448
N-(4-aminophenyl)-2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetamide;dihydrochloride (PubChem CID 69100448) has the molecular formula C20H26Cl2FN3O and a molecular weight of 414.35 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetamide;dihydrochloride.
| Compound Name | N-(4-aminophenyl)-2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 69100448 |
| Molecular Formula | C20H26Cl2FN3O |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-(4-aminophenyl)-2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(NC(=O)CN2CCC(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H24FN3O.2ClH/c21-17-3-1-15(2-4-17)13-16-9-11-24(12-10-16)14-20(25)23-19-7-5-18(22)6-8-19;;/h1-8,16H,9-14,22H2,(H,23,25);2*1H |
| InChIKey | HUBAEOBNMRZNGT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|