C21H23FN6O — CID 69100605
2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide (PubChem CID 69100605) has the molecular formula C21H23FN6O and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 69100605 |
| Molecular Formula | C21H23FN6O |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N-[3-(2H-tetrazol-5-yl)phenyl]acetamide |
| SMILES | O=C(CN1CCC(Cc2ccc(F)cc2)CC1)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C21H23FN6O/c22-18-6-4-15(5-7-18)12-16-8-10-28(11-9-16)14-20(29)23-19-3-1-2-17(13-19)21-24-26-27-25-21/h1-7,13,16H,8-12,14H2,(H,23,29)(H,24,25,26,27) |
| InChIKey | NLRIRMIINZLQRD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |