C17H23N3O2 — CID 18582367
N-(1-ethylindol-3-yl)-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 18582367) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(1-ethylindol-3-yl)-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | N-(1-ethylindol-3-yl)-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 18582367 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-(1-ethylindol-3-yl)-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)N2CC(C)OC(C)C2)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O2/c1-4-19-11-15(14-7-5-6-8-16(14)19)18-17(21)20-9-12(2)22-13(3)10-20/h5-8,11-13H,4,9-10H2,1-3H3,(H,18,21) |
| InChIKey | KFHGXUFCFBOELU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |