C22H24N2O2 — CID 96997373
(1-ethylindol-3-yl)-[(2S,6S)-2-methyl-6-phenylmorpholin-4-yl]methanone (PubChem CID 96997373) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (1-ethylindol-3-yl)-[(2S,6S)-2-methyl-6-phenylmorpholin-4-yl]methanone.
| Compound Name | (1-ethylindol-3-yl)-[(2S,6S)-2-methyl-6-phenylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 96997373 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (1-ethylindol-3-yl)-[(2S,6S)-2-methyl-6-phenylmorpholin-4-yl]methanone |
| SMILES | CCn1cc(C(=O)N2C[C@H](C)O[C@@H](c3ccccc3)C2)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O2/c1-3-23-14-19(18-11-7-8-12-20(18)23)22(25)24-13-16(2)26-21(15-24)17-9-5-4-6-10-17/h4-12,14,16,21H,3,13,15H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | MUJGQCMOPAREEN-HRAATJIYSA-N |
| XLogP | 4.26 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |