C18H17BrFNO2 — CID 47914309
(2-bromo-4-fluorophenyl)-(2-methyl-6-phenylmorpholin-4-yl)methanone (PubChem CID 47914309) has the molecular formula C18H17BrFNO2 and a molecular weight of 378.24 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-(2-methyl-6-phenylmorpholin-4-yl)methanone.
| Compound Name | (2-bromo-4-fluorophenyl)-(2-methyl-6-phenylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 47914309 |
| Molecular Formula | C18H17BrFNO2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-(2-methyl-6-phenylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(F)cc2Br)CC(c2ccccc2)O1 |
| InChI | InChI=1S/C18H17BrFNO2/c1-12-10-21(11-17(23-12)13-5-3-2-4-6-13)18(22)15-8-7-14(20)9-16(15)19/h2-9,12,17H,10-11H2,1H3 |
| InChIKey | QASVXYLXUWAFQM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |