C18H16ClF2NO2 — CID 110369220
(2-chloro-6-fluorophenyl)-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 110369220) has the molecular formula C18H16ClF2NO2 and a molecular weight of 351.78 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 110369220 |
| Molecular Formula | C18H16ClF2NO2 |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[2-(4-fluorophenyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2c(F)cccc2Cl)CC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C18H16ClF2NO2/c1-11-9-22(18(23)17-14(19)3-2-4-15(17)21)10-16(24-11)12-5-7-13(20)8-6-12/h2-8,11,16H,9-10H2,1H3 |
| InChIKey | WJBJKSNBPHCQLA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |