C23H31N3OS — CID 3454817
3-(2,4-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 3454817) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 3-(2,4-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 3454817 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-[(2-methoxyphenyl)methyl]-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | COc1ccccc1CN(C(=S)Nc1ccc(C)cc1C)C1CCN(C)CC1 |
| InChI | InChI=1S/C23H31N3OS/c1-17-9-10-21(18(2)15-17)24-23(28)26(20-11-13-25(3)14-12-20)16-19-7-5-6-8-22(19)27-4/h5-10,15,20H,11-14,16H2,1-4H3,(H,24,28) |
| InChIKey | GVECQTXDHMIAMS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|